C14H14ClN3O3 — CID 106820046
methyl 4-amino-2-(4-chloro-2-methoxyphenyl)-6-methylpyrimidine-5-carboxylate (PubChem CID 106820046) has the molecular formula C14H14ClN3O3 and a molecular weight of 307.74 g/mol. Its IUPAC name is methyl 4-amino-2-(4-chloro-2-methoxyphenyl)-6-methylpyrimidine-5-carboxylate.
| Compound Name | methyl 4-amino-2-(4-chloro-2-methoxyphenyl)-6-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 106820046 |
| Molecular Formula | C14H14ClN3O3 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | methyl 4-amino-2-(4-chloro-2-methoxyphenyl)-6-methylpyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(C)nc(-c2ccc(Cl)cc2OC)nc1N |
| InChI | InChI=1S/C14H14ClN3O3/c1-7-11(14(19)21-3)12(16)18-13(17-7)9-5-4-8(15)6-10(9)20-2/h4-6H,1-3H3,(H2,16,17,18) |
| InChIKey | OJQLUFKBVZKBQG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |