C14H14ClN3O2 — CID 116647802
ethyl 4-amino-2-(2-chlorophenyl)-6-methylpyrimidine-5-carboxylate (PubChem CID 116647802) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is ethyl 4-amino-2-(2-chlorophenyl)-6-methylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(2-chlorophenyl)-6-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 116647802 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | ethyl 4-amino-2-(2-chlorophenyl)-6-methylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(-c2ccccc2Cl)nc1N |
| InChI | InChI=1S/C14H14ClN3O2/c1-3-20-14(19)11-8(2)17-13(18-12(11)16)9-6-4-5-7-10(9)15/h4-7H,3H2,1-2H3,(H2,16,17,18) |
| InChIKey | HMPLQMCHFZRQSP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |