C13H12ClNO3 — CID 141465693
ethyl 5-(2-chlorophenyl)-3-methyl-1,2-oxazole-4-carboxylate (PubChem CID 141465693) has the molecular formula C13H12ClNO3 and a molecular weight of 265.70 g/mol. Its IUPAC name is ethyl 5-(2-chlorophenyl)-3-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-(2-chlorophenyl)-3-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 141465693 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | ethyl 5-(2-chlorophenyl)-3-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)noc1-c1ccccc1Cl |
| InChI | InChI=1S/C13H12ClNO3/c1-3-17-13(16)11-8(2)15-18-12(11)9-6-4-5-7-10(9)14/h4-7H,3H2,1-2H3 |
| InChIKey | BCPUTNNSJURWBT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |