C16H13Cl2F2IN4O4 — CID 157301933
methyl 4-amino-6-chloro-3-ethenyl-5-fluoropyridine-2-carboxylate;methyl 4-amino-6-chloro-5-fluoro-3-iodopyridine-2-carboxylate (PubChem CID 157301933) has the molecular formula C16H13Cl2F2IN4O4 and a molecular weight of 561.11 g/mol. Its IUPAC name is methyl 4-amino-6-chloro-3-ethenyl-5-fluoropyridine-2-carboxylate;methyl 4-amino-6-chloro-5-fluoro-3-iodopyridine-2-carboxylate.
| Compound Name | methyl 4-amino-6-chloro-3-ethenyl-5-fluoropyridine-2-carboxylate;methyl 4-amino-6-chloro-5-fluoro-3-iodopyridine-2-carboxylate |
|---|---|
| PubChem CID | 157301933 |
| Molecular Formula | C16H13Cl2F2IN4O4 |
| Molecular Weight | 561.11 g/mol |
| Exact Mass | 559.93 |
| IUPAC Name | methyl 4-amino-6-chloro-3-ethenyl-5-fluoropyridine-2-carboxylate;methyl 4-amino-6-chloro-5-fluoro-3-iodopyridine-2-carboxylate |
| SMILES | C=Cc1c(C(=O)OC)nc(Cl)c(F)c1N.COC(=O)c1nc(Cl)c(F)c(N)c1I |
| InChI | InChI=1S/C9H8ClFN2O2.C7H5ClFIN2O2/c1-3-4-6(12)5(11)8(10)13-7(4)9(14)15-2;1-14-7(13)5-3(10)4(11)2(9)6(8)12-5/h3H,1H2,2H3,(H2,12,13);1H3,(H2,11,12) |
| InChIKey | BBZTVQATWYTLIB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.11 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|