C7H5Cl3N2O2 — CID 86668297
methyl 3-amino-4,5,6-trichloropyridine-2-carboxylate (PubChem CID 86668297) has the molecular formula C7H5Cl3N2O2 and a molecular weight of 255.49 g/mol. Its IUPAC name is methyl 3-amino-4,5,6-trichloropyridine-2-carboxylate.
| Compound Name | methyl 3-amino-4,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 86668297 |
| Molecular Formula | C7H5Cl3N2O2 |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 253.94 |
| IUPAC Name | methyl 3-amino-4,5,6-trichloropyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)c(Cl)c(Cl)c1N |
| InChI | InChI=1S/C7H5Cl3N2O2/c1-14-7(13)5-4(11)2(8)3(9)6(10)12-5/h11H2,1H3 |
| InChIKey | DJUDHEMIGIHOCI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|