C7H6Cl2N2O2 — CID 130951422
methyl 6-amino-2,3-dichloropyridine-4-carboxylate (PubChem CID 130951422) has the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. Its IUPAC name is methyl 6-amino-2,3-dichloropyridine-4-carboxylate.
| Compound Name | methyl 6-amino-2,3-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 130951422 |
| Molecular Formula | C7H6Cl2N2O2 |
| Molecular Weight | 221.04 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | methyl 6-amino-2,3-dichloropyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(N)nc(Cl)c1Cl |
| InChI | InChI=1S/C7H6Cl2N2O2/c1-13-7(12)3-2-4(10)11-6(9)5(3)8/h2H,1H3,(H2,10,11) |
| InChIKey | ZAUFUJOFSJWIKS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.04 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|