C8H6ClN3O2S — CID 76849978
methyl 2-amino-5-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate (PubChem CID 76849978) has the molecular formula C8H6ClN3O2S and a molecular weight of 243.67 g/mol. Its IUPAC name is methyl 2-amino-5-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate.
| Compound Name | methyl 2-amino-5-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 76849978 |
| Molecular Formula | C8H6ClN3O2S |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | methyl 2-amino-5-chloro-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cc2sc(N)nc2nc1Cl |
| InChI | InChI=1S/C8H6ClN3O2S/c1-14-7(13)3-2-4-6(11-5(3)9)12-8(10)15-4/h2H,1H3,(H2,10,11,12) |
| InChIKey | HPFZOHVXGXODTN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|