C9H8N2O3S — CID 131616510
methyl 2-amino-4-hydroxy-1,3-benzothiazole-6-carboxylate (PubChem CID 131616510) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is methyl 2-amino-4-hydroxy-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-amino-4-hydroxy-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 131616510 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | methyl 2-amino-4-hydroxy-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1cc(O)c2nc(N)sc2c1 |
| InChI | InChI=1S/C9H8N2O3S/c1-14-8(13)4-2-5(12)7-6(3-4)15-9(10)11-7/h2-3,12H,1H3,(H2,10,11) |
| InChIKey | YOIMCEPCUUMEMY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |