C17H15F2N3O4S — CID 161113745
methyl 4-amino-3-fluorobenzoate;methyl 2-amino-4-fluoro-1,3-benzothiazole-6-carboxylate (PubChem CID 161113745) has the molecular formula C17H15F2N3O4S and a molecular weight of 395.39 g/mol. Its IUPAC name is methyl 4-amino-3-fluorobenzoate;methyl 2-amino-4-fluoro-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 4-amino-3-fluorobenzoate;methyl 2-amino-4-fluoro-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 161113745 |
| Molecular Formula | C17H15F2N3O4S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | methyl 4-amino-3-fluorobenzoate;methyl 2-amino-4-fluoro-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1cc(F)c2nc(N)sc2c1.COC(=O)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C9H7FN2O2S.C8H8FNO2/c1-14-8(13)4-2-5(10)7-6(3-4)15-9(11)12-7;1-12-8(11)5-2-3-7(10)6(9)4-5/h2-3H,1H3,(H2,11,12);2-4H,10H2,1H3 |
| InChIKey | UKAQXQPHHHKSFA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|