C11H15FN2S — CID 143324079
ethane;6-ethyl-4-fluoro-1,3-benzothiazol-2-amine (PubChem CID 143324079) has the molecular formula C11H15FN2S and a molecular weight of 226.32 g/mol. Its IUPAC name is ethane;6-ethyl-4-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | ethane;6-ethyl-4-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 143324079 |
| Molecular Formula | C11H15FN2S |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | ethane;6-ethyl-4-fluoro-1,3-benzothiazol-2-amine |
| SMILES | CC.CCc1cc(F)c2nc(N)sc2c1 |
| InChI | InChI=1S/C9H9FN2S.C2H6/c1-2-5-3-6(10)8-7(4-5)13-9(11)12-8;1-2/h3-4H,2H2,1H3,(H2,11,12);1-2H3 |
| InChIKey | KQBRAOWYRFTWTM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |