C10H9FN2OS — CID 145100828
2-ethyl-4-fluoro-1,3-benzothiazole-6-carboxamide (PubChem CID 145100828) has the molecular formula C10H9FN2OS and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-ethyl-4-fluoro-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-ethyl-4-fluoro-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 145100828 |
| Molecular Formula | C10H9FN2OS |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-ethyl-4-fluoro-1,3-benzothiazole-6-carboxamide |
| SMILES | CCc1nc2c(F)cc(C(N)=O)cc2s1 |
| InChI | InChI=1S/C10H9FN2OS/c1-2-8-13-9-6(11)3-5(10(12)14)4-7(9)15-8/h3-4H,2H2,1H3,(H2,12,14) |
| InChIKey | DTMJNTDBZXLJKL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |