C10H7Cl2FNO2S2+ — CID 134852120
dichloro-(6-ethoxycarbonyl-4-fluoro-1,3-benzothiazol-2-yl)sulfanium (PubChem CID 134852120) has the molecular formula C10H7Cl2FNO2S2+ and a molecular weight of 327.21 g/mol. Its IUPAC name is dichloro-(6-ethoxycarbonyl-4-fluoro-1,3-benzothiazol-2-yl)sulfanium.
| Compound Name | dichloro-(6-ethoxycarbonyl-4-fluoro-1,3-benzothiazol-2-yl)sulfanium |
|---|---|
| PubChem CID | 134852120 |
| Molecular Formula | C10H7Cl2FNO2S2+ |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 325.93 |
| IUPAC Name | dichloro-(6-ethoxycarbonyl-4-fluoro-1,3-benzothiazol-2-yl)sulfanium |
| SMILES | CCOC(=O)c1cc(F)c2nc([S+](Cl)Cl)sc2c1 |
| InChI | InChI=1S/C10H7Cl2FNO2S2/c1-2-16-9(15)5-3-6(13)8-7(4-5)17-10(14-8)18(11)12/h3-4H,2H2,1H3/q+1 |
| InChIKey | LVPIBHLNKLZBOI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|