C16H20FNO2S — CID 175901202
methyl 4-fluoro-2-heptan-2-yl-1,3-benzothiazole-6-carboxylate (PubChem CID 175901202) has the molecular formula C16H20FNO2S and a molecular weight of 309.41 g/mol. Its IUPAC name is methyl 4-fluoro-2-heptan-2-yl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 4-fluoro-2-heptan-2-yl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 175901202 |
| Molecular Formula | C16H20FNO2S |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | methyl 4-fluoro-2-heptan-2-yl-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCCC(C)c1nc2c(F)cc(C(=O)OC)cc2s1 |
| InChI | InChI=1S/C16H20FNO2S/c1-4-5-6-7-10(2)15-18-14-12(17)8-11(16(19)20-3)9-13(14)21-15/h8-10H,4-7H2,1-3H3 |
| InChIKey | VCNHSWLZGFLMEF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|