C12H14F2O3 — CID 118685930
methyl 4-butoxy-3,5-difluorobenzoate (PubChem CID 118685930) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is methyl 4-butoxy-3,5-difluorobenzoate.
| Compound Name | methyl 4-butoxy-3,5-difluorobenzoate |
|---|---|
| PubChem CID | 118685930 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | methyl 4-butoxy-3,5-difluorobenzoate |
| SMILES | CCCCOc1c(F)cc(C(=O)OC)cc1F |
| InChI | InChI=1S/C12H14F2O3/c1-3-4-5-17-11-9(13)6-8(7-10(11)14)12(15)16-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | QQTJITRBUAIZJC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|