C10H12F2N2S — CID 164903761
5,7-difluoro-4-methyl-1,3-benzothiazol-2-amine;ethane (PubChem CID 164903761) has the molecular formula C10H12F2N2S and a molecular weight of 230.28 g/mol. Its IUPAC name is 5,7-difluoro-4-methyl-1,3-benzothiazol-2-amine;ethane.
| Compound Name | 5,7-difluoro-4-methyl-1,3-benzothiazol-2-amine;ethane |
|---|---|
| PubChem CID | 164903761 |
| Molecular Formula | C10H12F2N2S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 5,7-difluoro-4-methyl-1,3-benzothiazol-2-amine;ethane |
| SMILES | CC.Cc1c(F)cc(F)c2sc(N)nc12 |
| InChI | InChI=1S/C8H6F2N2S.C2H6/c1-3-4(9)2-5(10)7-6(3)12-8(11)13-7;1-2/h2H,1H3,(H2,11,12);1-2H3 |
| InChIKey | TVMPQFAOMOOVAF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |