C10H13FN2S — CID 170624259
ethane;4-fluoro-7-methyl-1,3-benzothiazol-2-amine (PubChem CID 170624259) has the molecular formula C10H13FN2S and a molecular weight of 212.29 g/mol. Its IUPAC name is ethane;4-fluoro-7-methyl-1,3-benzothiazol-2-amine.
| Compound Name | ethane;4-fluoro-7-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 170624259 |
| Molecular Formula | C10H13FN2S |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | ethane;4-fluoro-7-methyl-1,3-benzothiazol-2-amine |
| SMILES | CC.Cc1ccc(F)c2nc(N)sc12 |
| InChI | InChI=1S/C8H7FN2S.C2H6/c1-4-2-3-5(9)6-7(4)12-8(10)11-6;1-2/h2-3H,1H3,(H2,10,11);1-2H3 |
| InChIKey | KFBLFKHZAMYUHB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |