C10H14N2S — CID 145229786
ethane;7-methyl-1,3-benzothiazol-2-amine (PubChem CID 145229786) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is ethane;7-methyl-1,3-benzothiazol-2-amine.
| Compound Name | ethane;7-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 145229786 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | ethane;7-methyl-1,3-benzothiazol-2-amine |
| SMILES | CC.Cc1cccc2nc(N)sc12 |
| InChI | InChI=1S/C8H8N2S.C2H6/c1-5-3-2-4-6-7(5)11-8(9)10-6;1-2/h2-4H,1H3,(H2,9,10);1-2H3 |
| InChIKey | JWHNYMPGZSXICX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |