C12H19FN2S — CID 170572306
ethane;7-fluoro-4-methyl-1,3-benzothiazol-2-amine (PubChem CID 170572306) has the molecular formula C12H19FN2S and a molecular weight of 242.36 g/mol. Its IUPAC name is ethane;7-fluoro-4-methyl-1,3-benzothiazol-2-amine.
| Compound Name | ethane;7-fluoro-4-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 170572306 |
| Molecular Formula | C12H19FN2S |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | ethane;7-fluoro-4-methyl-1,3-benzothiazol-2-amine |
| SMILES | CC.CC.Cc1ccc(F)c2sc(N)nc12 |
| InChI | InChI=1S/C8H7FN2S.2C2H6/c1-4-2-3-5(9)7-6(4)11-8(10)12-7;2*1-2/h2-3H,1H3,(H2,10,11);2*1-2H3 |
| InChIKey | ITALIPXINRZEEN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |