C10H14FN2PS — CID 176951023
ethane;4-fluoro-7-methylphosphanyl-1,3-benzothiazol-2-amine (PubChem CID 176951023) has the molecular formula C10H14FN2PS and a molecular weight of 244.28 g/mol. Its IUPAC name is ethane;4-fluoro-7-methylphosphanyl-1,3-benzothiazol-2-amine.
| Compound Name | ethane;4-fluoro-7-methylphosphanyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 176951023 |
| Molecular Formula | C10H14FN2PS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | ethane;4-fluoro-7-methylphosphanyl-1,3-benzothiazol-2-amine |
| SMILES | CC.CPc1ccc(F)c2nc(N)sc12 |
| InChI | InChI=1S/C8H8FN2PS.C2H6/c1-12-5-3-2-4(9)6-7(5)13-8(10)11-6;1-2/h2-3,12H,1H3,(H2,10,11);1-2H3 |
| InChIKey | XJIIAVYKCGEOOZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|