C11H13FN2S — CID 166533290
5-fluoro-7-methyl-4-propan-2-yl-1,3-benzothiazol-2-amine (PubChem CID 166533290) has the molecular formula C11H13FN2S and a molecular weight of 224.30 g/mol. Its IUPAC name is 5-fluoro-7-methyl-4-propan-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | 5-fluoro-7-methyl-4-propan-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 166533290 |
| Molecular Formula | C11H13FN2S |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 5-fluoro-7-methyl-4-propan-2-yl-1,3-benzothiazol-2-amine |
| SMILES | Cc1cc(F)c(C(C)C)c2nc(N)sc12 |
| InChI | InChI=1S/C11H13FN2S/c1-5(2)8-7(12)4-6(3)10-9(8)14-11(13)15-10/h4-5H,1-3H3,(H2,13,14) |
| InChIKey | GTVNHMFHVRDTRW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |