C11H14N2OS3 — CID 59043012
4-methyl-7-propan-2-yl-6-(tritiooxydisulfanyl)-1,3-benzothiazol-2-amine (PubChem CID 59043012) has the molecular formula C11H14N2OS3 and a molecular weight of 288.46 g/mol. Its IUPAC name is 4-methyl-7-propan-2-yl-6-(tritiooxydisulfanyl)-1,3-benzothiazol-2-amine.
| Compound Name | 4-methyl-7-propan-2-yl-6-(tritiooxydisulfanyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 59043012 |
| Molecular Formula | C11H14N2OS3 |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 4-methyl-7-propan-2-yl-6-(tritiooxydisulfanyl)-1,3-benzothiazol-2-amine |
| SMILES | [3H]OSSc1cc(C)c2nc(N)sc2c1C(C)C |
| InChI | InChI=1S/C11H14N2OS3/c1-5(2)8-7(16-17-14)4-6(3)9-10(8)15-11(12)13-9/h4-5,14H,1-3H3,(H2,12,13)/i/hT |
| InChIKey | MYQOYLQUQOMFSG-MNYXATJNSA-N |
| XLogP | 4.52 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|