C8H7IN2S — CID 130498154
7-iodo-4-methyl-1,3-benzothiazol-2-amine (PubChem CID 130498154) has the molecular formula C8H7IN2S and a molecular weight of 290.13 g/mol. Its IUPAC name is 7-iodo-4-methyl-1,3-benzothiazol-2-amine.
| Compound Name | 7-iodo-4-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 130498154 |
| Molecular Formula | C8H7IN2S |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | 7-iodo-4-methyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc(I)c2sc(N)nc12 |
| InChI | InChI=1S/C8H7IN2S/c1-4-2-3-5(9)7-6(4)11-8(10)12-7/h2-3H,1H3,(H2,10,11) |
| InChIKey | NIIQTXXCJVMXGR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|