C9H11N3S — CID 2049854
(4,7-dimethyl-1,3-benzothiazol-2-yl)hydrazine (PubChem CID 2049854) has the molecular formula C9H11N3S and a molecular weight of 193.28 g/mol. Its IUPAC name is (4,7-dimethyl-1,3-benzothiazol-2-yl)hydrazine.
| Compound Name | (4,7-dimethyl-1,3-benzothiazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 2049854 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (4,7-dimethyl-1,3-benzothiazol-2-yl)hydrazine |
| SMILES | Cc1ccc(C)c2sc(NN)nc12 |
| InChI | InChI=1S/C9H11N3S/c1-5-3-4-6(2)8-7(5)11-9(12-10)13-8/h3-4H,10H2,1-2H3,(H,11,12) |
| InChIKey | JDPZTUCZLBRFDA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|