C17H17NS — CID 135196378
2-(3,5-dimethylphenyl)-4,7-dimethyl-1,3-benzothiazole (PubChem CID 135196378) has the molecular formula C17H17NS and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-4,7-dimethyl-1,3-benzothiazole.
| Compound Name | 2-(3,5-dimethylphenyl)-4,7-dimethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 135196378 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-4,7-dimethyl-1,3-benzothiazole |
| SMILES | Cc1cc(C)cc(-c2nc3c(C)ccc(C)c3s2)c1 |
| InChI | InChI=1S/C17H17NS/c1-10-7-11(2)9-14(8-10)17-18-15-12(3)5-6-13(4)16(15)19-17/h5-9H,1-4H3 |
| InChIKey | UYHUPPATYPLLAW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |