C14H12N2S — CID 82231870
2-(3-methylphenyl)-1,3-benzothiazol-7-amine (PubChem CID 82231870) has the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-(3-methylphenyl)-1,3-benzothiazol-7-amine.
| Compound Name | 2-(3-methylphenyl)-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 82231870 |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-(3-methylphenyl)-1,3-benzothiazol-7-amine |
| SMILES | Cc1cccc(-c2nc3cccc(N)c3s2)c1 |
| InChI | InChI=1S/C14H12N2S/c1-9-4-2-5-10(8-9)14-16-12-7-3-6-11(15)13(12)17-14/h2-8H,15H2,1H3 |
| InChIKey | QTAZEMXSXREKNF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|