C13H8Cl2N2S — CID 43306332
2-chloro-5-(7-chloro-1,3-benzothiazol-2-yl)aniline (PubChem CID 43306332) has the molecular formula C13H8Cl2N2S and a molecular weight of 295.19 g/mol. Its IUPAC name is 2-chloro-5-(7-chloro-1,3-benzothiazol-2-yl)aniline.
| Compound Name | 2-chloro-5-(7-chloro-1,3-benzothiazol-2-yl)aniline |
|---|---|
| PubChem CID | 43306332 |
| Molecular Formula | C13H8Cl2N2S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 2-chloro-5-(7-chloro-1,3-benzothiazol-2-yl)aniline |
| SMILES | Nc1cc(-c2nc3cccc(Cl)c3s2)ccc1Cl |
| InChI | InChI=1S/C13H8Cl2N2S/c14-8-5-4-7(6-10(8)16)13-17-11-3-1-2-9(15)12(11)18-13/h1-6H,16H2 |
| InChIKey | KYRJJZLGZJEURS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|