C7H3ClNS2- — CID 86306807
7-chloro-1,3-benzothiazole-2-thiolate (PubChem CID 86306807) has the molecular formula C7H3ClNS2- and a molecular weight of 200.70 g/mol. Its IUPAC name is 7-chloro-1,3-benzothiazole-2-thiolate.
| Compound Name | 7-chloro-1,3-benzothiazole-2-thiolate |
|---|---|
| PubChem CID | 86306807 |
| Molecular Formula | C7H3ClNS2- |
| Molecular Weight | 200.70 g/mol |
| Exact Mass | 199.94 |
| IUPAC Name | 7-chloro-1,3-benzothiazole-2-thiolate |
| SMILES | [S-]c1nc2cccc(Cl)c2s1 |
| InChI | InChI=1S/C7H4ClNS2/c8-4-2-1-3-5-6(4)11-7(10)9-5/h1-3H,(H,9,10)/p-1 |
| InChIKey | VPDPFMGWDPYVEK-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.70 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|