C13H8ClNO2S — CID 107704631
5-(7-chloro-1,3-benzothiazol-2-yl)benzene-1,3-diol (PubChem CID 107704631) has the molecular formula C13H8ClNO2S and a molecular weight of 277.73 g/mol. Its IUPAC name is 5-(7-chloro-1,3-benzothiazol-2-yl)benzene-1,3-diol.
| Compound Name | 5-(7-chloro-1,3-benzothiazol-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 107704631 |
| Molecular Formula | C13H8ClNO2S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 5-(7-chloro-1,3-benzothiazol-2-yl)benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(-c2nc3cccc(Cl)c3s2)c1 |
| InChI | InChI=1S/C13H8ClNO2S/c14-10-2-1-3-11-12(10)18-13(15-11)7-4-8(16)6-9(17)5-7/h1-6,16-17H |
| InChIKey | DEKBXOAVLKDPDS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |