C13H8ClN3O2S — CID 60835566
4-(7-chloro-1,3-benzothiazol-2-yl)-2-nitroaniline (PubChem CID 60835566) has the molecular formula C13H8ClN3O2S and a molecular weight of 305.75 g/mol. Its IUPAC name is 4-(7-chloro-1,3-benzothiazol-2-yl)-2-nitroaniline.
| Compound Name | 4-(7-chloro-1,3-benzothiazol-2-yl)-2-nitroaniline |
|---|---|
| PubChem CID | 60835566 |
| Molecular Formula | C13H8ClN3O2S |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 4-(7-chloro-1,3-benzothiazol-2-yl)-2-nitroaniline |
| SMILES | Nc1ccc(-c2nc3cccc(Cl)c3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H8ClN3O2S/c14-8-2-1-3-10-12(8)20-13(16-10)7-4-5-9(15)11(6-7)17(18)19/h1-6H,15H2 |
| InChIKey | DUBFOLSGOQRPHP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|