C10H11ClN2OS — CID 43306322
1-amino-1-(7-chloro-1,3-benzothiazol-2-yl)propan-2-ol (PubChem CID 43306322) has the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. Its IUPAC name is 1-amino-1-(7-chloro-1,3-benzothiazol-2-yl)propan-2-ol.
| Compound Name | 1-amino-1-(7-chloro-1,3-benzothiazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 43306322 |
| Molecular Formula | C10H11ClN2OS |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1-amino-1-(7-chloro-1,3-benzothiazol-2-yl)propan-2-ol |
| SMILES | CC(O)C(N)c1nc2cccc(Cl)c2s1 |
| InChI | InChI=1S/C10H11ClN2OS/c1-5(14)8(12)10-13-7-4-2-3-6(11)9(7)15-10/h2-5,8,14H,12H2,1H3 |
| InChIKey | HTZZQIXFVTXFES-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |