C16H15ClN2S — CID 104503119
4-[1-(7-chloro-1,3-benzothiazol-2-yl)propan-2-yl]aniline (PubChem CID 104503119) has the molecular formula C16H15ClN2S and a molecular weight of 302.83 g/mol. Its IUPAC name is 4-[1-(7-chloro-1,3-benzothiazol-2-yl)propan-2-yl]aniline.
| Compound Name | 4-[1-(7-chloro-1,3-benzothiazol-2-yl)propan-2-yl]aniline |
|---|---|
| PubChem CID | 104503119 |
| Molecular Formula | C16H15ClN2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-[1-(7-chloro-1,3-benzothiazol-2-yl)propan-2-yl]aniline |
| SMILES | CC(Cc1nc2cccc(Cl)c2s1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H15ClN2S/c1-10(11-5-7-12(18)8-6-11)9-15-19-14-4-2-3-13(17)16(14)20-15/h2-8,10H,9,18H2,1H3 |
| InChIKey | QSAZYAMRBYRRHB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|