C11H13ClN2OS — CID 103157437
3-(7-chloro-1,3-benzothiazol-2-yl)-2-methoxypropan-1-amine (PubChem CID 103157437) has the molecular formula C11H13ClN2OS and a molecular weight of 256.76 g/mol. Its IUPAC name is 3-(7-chloro-1,3-benzothiazol-2-yl)-2-methoxypropan-1-amine.
| Compound Name | 3-(7-chloro-1,3-benzothiazol-2-yl)-2-methoxypropan-1-amine |
|---|---|
| PubChem CID | 103157437 |
| Molecular Formula | C11H13ClN2OS |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 3-(7-chloro-1,3-benzothiazol-2-yl)-2-methoxypropan-1-amine |
| SMILES | COC(CN)Cc1nc2cccc(Cl)c2s1 |
| InChI | InChI=1S/C11H13ClN2OS/c1-15-7(6-13)5-10-14-9-4-2-3-8(12)11(9)16-10/h2-4,7H,5-6,13H2,1H3 |
| InChIKey | FKYIFXQYIQPJGP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |