C15H13ClN2S — CID 55078389
1-(7-chloro-1,3-benzothiazol-2-yl)-1-phenylethanamine (PubChem CID 55078389) has the molecular formula C15H13ClN2S and a molecular weight of 288.80 g/mol. Its IUPAC name is 1-(7-chloro-1,3-benzothiazol-2-yl)-1-phenylethanamine.
| Compound Name | 1-(7-chloro-1,3-benzothiazol-2-yl)-1-phenylethanamine |
|---|---|
| PubChem CID | 55078389 |
| Molecular Formula | C15H13ClN2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 1-(7-chloro-1,3-benzothiazol-2-yl)-1-phenylethanamine |
| SMILES | CC(N)(c1ccccc1)c1nc2cccc(Cl)c2s1 |
| InChI | InChI=1S/C15H13ClN2S/c1-15(17,10-6-3-2-4-7-10)14-18-12-9-5-8-11(16)13(12)19-14/h2-9H,17H2,1H3 |
| InChIKey | BAYMQSSRUATTTE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |