C16H14ClFN2O — CID 104503233
4-[1-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)propan-2-yl]aniline (PubChem CID 104503233) has the molecular formula C16H14ClFN2O and a molecular weight of 304.75 g/mol. Its IUPAC name is 4-[1-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)propan-2-yl]aniline.
| Compound Name | 4-[1-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)propan-2-yl]aniline |
|---|---|
| PubChem CID | 104503233 |
| Molecular Formula | C16H14ClFN2O |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-[1-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)propan-2-yl]aniline |
| SMILES | CC(Cc1nc2cc(Cl)c(F)cc2o1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H14ClFN2O/c1-9(10-2-4-11(19)5-3-10)6-16-20-14-7-12(17)13(18)8-15(14)21-16/h2-5,7-9H,6,19H2,1H3 |
| InChIKey | INJVUZZYZJAPCN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|