C12H15ClN2O — CID 115539596
5-chloro-2-(2,2-dimethylpropyl)-1,3-benzoxazol-6-amine (PubChem CID 115539596) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 5-chloro-2-(2,2-dimethylpropyl)-1,3-benzoxazol-6-amine.
| Compound Name | 5-chloro-2-(2,2-dimethylpropyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 115539596 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 5-chloro-2-(2,2-dimethylpropyl)-1,3-benzoxazol-6-amine |
| SMILES | CC(C)(C)Cc1nc2cc(Cl)c(N)cc2o1 |
| InChI | InChI=1S/C12H15ClN2O/c1-12(2,3)6-11-15-9-4-7(13)8(14)5-10(9)16-11/h4-5H,6,14H2,1-3H3 |
| InChIKey | NDZJHHGLVDNBNE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|