C13H16ClN3O — CID 115539881
5-chloro-2-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine (PubChem CID 115539881) has the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. Its IUPAC name is 5-chloro-2-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine.
| Compound Name | 5-chloro-2-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 115539881 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 5-chloro-2-(2-pyrrolidin-1-ylethyl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1cc2oc(CCN3CCCC3)nc2cc1Cl |
| InChI | InChI=1S/C13H16ClN3O/c14-9-7-11-12(8-10(9)15)18-13(16-11)3-6-17-4-1-2-5-17/h7-8H,1-6,15H2 |
| InChIKey | QVWPSEOGOPZXRV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|