C10H10Cl2N2O — CID 82232079
3-(5,6-dichloro-1,3-benzoxazol-2-yl)propan-1-amine (PubChem CID 82232079) has the molecular formula C10H10Cl2N2O and a molecular weight of 245.11 g/mol. Its IUPAC name is 3-(5,6-dichloro-1,3-benzoxazol-2-yl)propan-1-amine.
| Compound Name | 3-(5,6-dichloro-1,3-benzoxazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 82232079 |
| Molecular Formula | C10H10Cl2N2O |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 3-(5,6-dichloro-1,3-benzoxazol-2-yl)propan-1-amine |
| SMILES | NCCCc1nc2cc(Cl)c(Cl)cc2o1 |
| InChI | InChI=1S/C10H10Cl2N2O/c11-6-4-8-9(5-7(6)12)15-10(14-8)2-1-3-13/h4-5H,1-3,13H2 |
| InChIKey | PJASDXNXTPWMOX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |