C11H13ClN2O — CID 82231160
3-(6-chloro-5-methyl-1,3-benzoxazol-2-yl)propan-1-amine (PubChem CID 82231160) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is 3-(6-chloro-5-methyl-1,3-benzoxazol-2-yl)propan-1-amine.
| Compound Name | 3-(6-chloro-5-methyl-1,3-benzoxazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 82231160 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 3-(6-chloro-5-methyl-1,3-benzoxazol-2-yl)propan-1-amine |
| SMILES | Cc1cc2nc(CCCN)oc2cc1Cl |
| InChI | InChI=1S/C11H13ClN2O/c1-7-5-9-10(6-8(7)12)15-11(14-9)3-2-4-13/h5-6H,2-4,13H2,1H3 |
| InChIKey | WQIVLFYBDCTWKG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |