C10H11NO3S — CID 174492351
(5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid (PubChem CID 174492351) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid.
| Compound Name | (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid |
|---|---|
| PubChem CID | 174492351 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid |
| SMILES | Cc1cc2nc(CS(=O)O)oc2cc1C |
| InChI | InChI=1S/C10H11NO3S/c1-6-3-8-9(4-7(6)2)14-10(11-8)5-15(12)13/h3-4H,5H2,1-2H3,(H,12,13) |
| InChIKey | MSOBNNZEEAQSOY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|