(5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid

C10H11NO3S — CID 174492351

IUPAC(5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid
SMILESCc1cc2nc(CS(=O)O)oc2cc1C
InChIInChI=1S/C10H11NO3S/c1-6-3-8-9(4-7(6)2)14-10(11-8)5-15(12)13/h3-4H,5H2,1-2H3,(H,12,13)
InChIKeyMSOBNNZEEAQSOY-UHFFFAOYSA-N
MW225.27 g/mol
LogP2.17
Rot. Bonds2

About (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid

(5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid (PubChem CID 174492351) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid.

Molecular Properties

Compound Name(5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid
PubChem CID174492351
Molecular FormulaC10H11NO3S
Molecular Weight225.27 g/mol
Exact Mass225.05
IUPAC Name(5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid
SMILESCc1cc2nc(CS(=O)O)oc2cc1C
InChIInChI=1S/C10H11NO3S/c1-6-3-8-9(4-7(6)2)14-10(11-8)5-15(12)13/h3-4H,5H2,1-2H3,(H,12,13)
InChIKeyMSOBNNZEEAQSOY-UHFFFAOYSA-N
XLogP2.17
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.27
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid?
The IUPAC name of (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid (CID 174492351) is (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid.
What is the SMILES notation for (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid?
The canonical SMILES for (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid is Cc1cc2nc(CS(=O)O)oc2cc1C.
What is the InChIKey of (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid?
The InChIKey is MSOBNNZEEAQSOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3S/c1-6-3-8-9(4-7(6)2)14-10(11-8)5-15(12)13/h3-4H,5H2,1-2H3,(H,12,13).
What are the key properties of (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid?
(5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid has a molecular weight of 225.27 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-dimethyl-1,3-benzoxazol-2-yl)methanesulfinic acid is sourced from PubChem (CID 174492351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).