C28H29N3O2S — CID 54859980
4-tert-butyl-N-[[4-[(5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]benzamide (PubChem CID 54859980) has the molecular formula C28H29N3O2S and a molecular weight of 471.63 g/mol. Its IUPAC name is 4-tert-butyl-N-[[4-[(5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[4-[(5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54859980 |
| Molecular Formula | C28H29N3O2S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 4-tert-butyl-N-[[4-[(5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1cc2nc(Cc3ccc(NC(=S)NC(=O)c4ccc(C(C)(C)C)cc4)cc3)oc2cc1C |
| InChI | InChI=1S/C28H29N3O2S/c1-17-14-23-24(15-18(17)2)33-25(30-23)16-19-6-12-22(13-7-19)29-27(34)31-26(32)20-8-10-21(11-9-20)28(3,4)5/h6-15H,16H2,1-5H3,(H2,29,31,32,34) |
| InChIKey | WQSLVQZQLFBVML-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|