C27H28N2O2 — CID 54857974
4-tert-butyl-N-[4-[(5-ethyl-1,3-benzoxazol-2-yl)methyl]phenyl]benzamide (PubChem CID 54857974) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[(5-ethyl-1,3-benzoxazol-2-yl)methyl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[(5-ethyl-1,3-benzoxazol-2-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 54857974 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 4-tert-butyl-N-[4-[(5-ethyl-1,3-benzoxazol-2-yl)methyl]phenyl]benzamide |
| SMILES | CCc1ccc2oc(Cc3ccc(NC(=O)c4ccc(C(C)(C)C)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C27H28N2O2/c1-5-18-8-15-24-23(16-18)29-25(31-24)17-19-6-13-22(14-7-19)28-26(30)20-9-11-21(12-10-20)27(2,3)4/h6-16H,5,17H2,1-4H3,(H,28,30) |
| InChIKey | MIQZAXQFWMEIBS-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |