C12H13ClFNO — CID 82231943
6-chloro-2-(2,2-dimethylpropyl)-5-fluoro-1,3-benzoxazole (PubChem CID 82231943) has the molecular formula C12H13ClFNO and a molecular weight of 241.69 g/mol. Its IUPAC name is 6-chloro-2-(2,2-dimethylpropyl)-5-fluoro-1,3-benzoxazole.
| Compound Name | 6-chloro-2-(2,2-dimethylpropyl)-5-fluoro-1,3-benzoxazole |
|---|---|
| PubChem CID | 82231943 |
| Molecular Formula | C12H13ClFNO |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 6-chloro-2-(2,2-dimethylpropyl)-5-fluoro-1,3-benzoxazole |
| SMILES | CC(C)(C)Cc1nc2cc(F)c(Cl)cc2o1 |
| InChI | InChI=1S/C12H13ClFNO/c1-12(2,3)6-11-15-9-5-8(14)7(13)4-10(9)16-11/h4-5H,6H2,1-3H3 |
| InChIKey | GOYLSGVORSLNON-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |