C11H12ClFN2O2 — CID 82720961
N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methoxyethanamine (PubChem CID 82720961) has the molecular formula C11H12ClFN2O2 and a molecular weight of 258.68 g/mol. Its IUPAC name is N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 82720961 |
| Molecular Formula | C11H12ClFN2O2 |
| Molecular Weight | 258.68 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-[(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nc2cc(Cl)c(F)cc2o1 |
| InChI | InChI=1S/C11H12ClFN2O2/c1-16-3-2-14-6-11-15-9-4-7(12)8(13)5-10(9)17-11/h4-5,14H,2-3,6H2,1H3 |
| InChIKey | BNSSQEBMXIATQR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.68 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|