C12H14ClFN2O2 — CID 82719839
1-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4-methoxybutan-1-amine (PubChem CID 82719839) has the molecular formula C12H14ClFN2O2 and a molecular weight of 272.71 g/mol. Its IUPAC name is 1-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4-methoxybutan-1-amine.
| Compound Name | 1-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 82719839 |
| Molecular Formula | C12H14ClFN2O2 |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 1-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)-4-methoxybutan-1-amine |
| SMILES | COCCCC(N)c1nc2cc(Cl)c(F)cc2o1 |
| InChI | InChI=1S/C12H14ClFN2O2/c1-17-4-2-3-9(15)12-16-10-5-7(13)8(14)6-11(10)18-12/h5-6,9H,2-4,15H2,1H3 |
| InChIKey | ZUWAGIQIOKXBFF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|