C11H13FN2O2 — CID 63675448
1-(6-fluoro-1,3-benzoxazol-2-yl)-3-methoxypropan-1-amine (PubChem CID 63675448) has the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. Its IUPAC name is 1-(6-fluoro-1,3-benzoxazol-2-yl)-3-methoxypropan-1-amine.
| Compound Name | 1-(6-fluoro-1,3-benzoxazol-2-yl)-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 63675448 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(6-fluoro-1,3-benzoxazol-2-yl)-3-methoxypropan-1-amine |
| SMILES | COCCC(N)c1nc2ccc(F)cc2o1 |
| InChI | InChI=1S/C11H13FN2O2/c1-15-5-4-8(13)11-14-9-3-2-7(12)6-10(9)16-11/h2-3,6,8H,4-5,13H2,1H3 |
| InChIKey | SCWQXIUIOLYGCU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |