C12H15FN2O — CID 63676371
1-(6-fluoro-1,3-benzoxazol-2-yl)-3-methylbutan-1-amine (PubChem CID 63676371) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is 1-(6-fluoro-1,3-benzoxazol-2-yl)-3-methylbutan-1-amine.
| Compound Name | 1-(6-fluoro-1,3-benzoxazol-2-yl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 63676371 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-(6-fluoro-1,3-benzoxazol-2-yl)-3-methylbutan-1-amine |
| SMILES | CC(C)CC(N)c1nc2ccc(F)cc2o1 |
| InChI | InChI=1S/C12H15FN2O/c1-7(2)5-9(14)12-15-10-4-3-8(13)6-11(10)16-12/h3-4,6-7,9H,5,14H2,1-2H3 |
| InChIKey | JLADJLRTSBZDQN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |