C11H14N2O — CID 82357425
(2-propan-2-yl-1,3-benzoxazol-6-yl)methanamine (PubChem CID 82357425) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (2-propan-2-yl-1,3-benzoxazol-6-yl)methanamine.
| Compound Name | (2-propan-2-yl-1,3-benzoxazol-6-yl)methanamine |
|---|---|
| PubChem CID | 82357425 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (2-propan-2-yl-1,3-benzoxazol-6-yl)methanamine |
| SMILES | CC(C)c1nc2ccc(CN)cc2o1 |
| InChI | InChI=1S/C11H14N2O/c1-7(2)11-13-9-4-3-8(6-12)5-10(9)14-11/h3-5,7H,6,12H2,1-2H3 |
| InChIKey | YDHVBHWFJKOMQT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |