C12H10N2O2 — CID 82357432
[2-(furan-2-yl)-1,3-benzoxazol-6-yl]methanamine (PubChem CID 82357432) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is [2-(furan-2-yl)-1,3-benzoxazol-6-yl]methanamine.
| Compound Name | [2-(furan-2-yl)-1,3-benzoxazol-6-yl]methanamine |
|---|---|
| PubChem CID | 82357432 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | [2-(furan-2-yl)-1,3-benzoxazol-6-yl]methanamine |
| SMILES | NCc1ccc2nc(-c3ccco3)oc2c1 |
| InChI | InChI=1S/C12H10N2O2/c13-7-8-3-4-9-11(6-8)16-12(14-9)10-2-1-5-15-10/h1-6H,7,13H2 |
| InChIKey | OYDDZUGBJBZSJA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |