C16H16N2O3 — CID 171115267
N,N-diethyl-2-(furan-2-yl)-1,3-benzoxazole-6-carboxamide (PubChem CID 171115267) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is N,N-diethyl-2-(furan-2-yl)-1,3-benzoxazole-6-carboxamide.
| Compound Name | N,N-diethyl-2-(furan-2-yl)-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 171115267 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N,N-diethyl-2-(furan-2-yl)-1,3-benzoxazole-6-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2nc(-c3ccco3)oc2c1 |
| InChI | InChI=1S/C16H16N2O3/c1-3-18(4-2)16(19)11-7-8-12-14(10-11)21-15(17-12)13-6-5-9-20-13/h5-10H,3-4H2,1-2H3 |
| InChIKey | GZZWWIZLAKBDNZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 59.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |