About (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine
(4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine (PubChem CID 130449908) has the molecular formula C18H14N2O
and a molecular weight of 274.32 g/mol. Its IUPAC name is (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine.
Molecular Properties
| Compound Name | (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine |
| PubChem CID | 130449908 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine |
| SMILES | NCc1ccc(-c2nc3cc4ccccc4cc3o2)cc1 |
| InChI | InChI=1S/C18H14N2O/c19-11-12-5-7-13(8-6-12)18-20-16-9-14-3-1-2-4-15(14)10-17(16)21-18/h1-10H,11,19H2 |
| InChIKey | PCQUMKZLVXUAMT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine?
The IUPAC name of (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine (CID 130449908) is (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine.
What is the SMILES notation for (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine?
The canonical SMILES for (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine is NCc1ccc(-c2nc3cc4ccccc4cc3o2)cc1.
What is the InChIKey of (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine?
The InChIKey is PCQUMKZLVXUAMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O/c19-11-12-5-7-13(8-6-12)18-20-16-9-14-3-1-2-4-15(14)10-17(16)21-18/h1-10H,11,19H2.
What are the key properties of (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine?
(4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine has a molecular weight of 274.32 g/mol, XLogP of 4.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzo[f][1,3]benzoxazol-2-ylphenyl)methanamine is sourced from PubChem (CID 130449908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).